C18H15NO3 — CID 5479541
6-hydroxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one (PubChem CID 5479541) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 6-hydroxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one.
| Compound Name | 6-hydroxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 5479541 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 6-hydroxy-3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one |
| SMILES | CC1(C)C=Cc2c(cc(O)c3c(=O)c4ccccc4[nH]c23)O1 |
| InChI | InChI=1S/C18H15NO3/c1-18(2)8-7-11-14(22-18)9-13(20)15-16(11)19-12-6-4-3-5-10(12)17(15)21/h3-9,20H,1-2H3,(H,19,21) |
| InChIKey | RPWNPBFZWFWZNJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|