C38H32N2O9 — CID 163012107
11-[[(3R)-6,11-dihydroxy-3,12-dimethyl-7-oxopyrano[2,3-c]acridin-3-yl]methoxy]-6,10-dihydroxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one (PubChem CID 163012107) has the molecular formula C38H32N2O9 and a molecular weight of 660.68 g/mol. Its IUPAC name is 11-[[(3R)-6,11-dihydroxy-3,12-dimethyl-7-oxopyrano[2,3-c]acridin-3-yl]methoxy]-6,10-dihydroxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one.
| Compound Name | 11-[[(3R)-6,11-dihydroxy-3,12-dimethyl-7-oxopyrano[2,3-c]acridin-3-yl]methoxy]-6,10-dihydroxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 163012107 |
| Molecular Formula | C38H32N2O9 |
| Molecular Weight | 660.68 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | 11-[[(3R)-6,11-dihydroxy-3,12-dimethyl-7-oxopyrano[2,3-c]acridin-3-yl]methoxy]-6,10-dihydroxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one |
| SMILES | Cn1c2c(O)cccc2c(=O)c2c(O)cc3c(c21)C=C[C@](C)(COc1c(O)ccc2c(=O)c4c(O)cc5c(c4n(C)c12)C=CC(C)(C)O5)O3 |
| InChI | InChI=1S/C38H32N2O9/c1-37(2)13-11-18-26(48-37)15-24(43)29-32(18)40(5)33-21(35(29)46)9-10-23(42)36(33)47-17-38(3)14-12-19-27(49-38)16-25(44)28-31(19)39(4)30-20(34(28)45)7-6-8-22(30)41/h6-16,41-44H,17H2,1-5H3/t38-/m1/s1 |
| InChIKey | YSTMDXZQPAOBAY-KXQOOQHDSA-N |
| XLogP | 5.95 |
| TPSA | 152.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|