C28H28O6 — CID 162986751
11,22-dihydroxy-7,7,19-trimethyl-19-(4-methylpent-3-enyl)-2,8,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4(9),5,10,15,17,21-octaen-13-one (PubChem CID 162986751) has the molecular formula C28H28O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is 11,22-dihydroxy-7,7,19-trimethyl-19-(4-methylpent-3-enyl)-2,8,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4(9),5,10,15,17,21-octaen-13-one.
| Compound Name | 11,22-dihydroxy-7,7,19-trimethyl-19-(4-methylpent-3-enyl)-2,8,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4(9),5,10,15,17,21-octaen-13-one |
|---|---|
| PubChem CID | 162986751 |
| Molecular Formula | C28H28O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 11,22-dihydroxy-7,7,19-trimethyl-19-(4-methylpent-3-enyl)-2,8,20-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4(9),5,10,15,17,21-octaen-13-one |
| SMILES | CC(C)=CCCC1(C)C=Cc2cc3c(=O)c4c(O)cc5c(c4oc3c(O)c2O1)C=CC(C)(C)O5 |
| InChI | InChI=1S/C28H28O6/c1-15(2)7-6-10-28(5)12-8-16-13-18-22(30)21-19(29)14-20-17(9-11-27(3,4)33-20)25(21)32-26(18)23(31)24(16)34-28/h7-9,11-14,29,31H,6,10H2,1-5H3 |
| InChIKey | RXLXNBUNYYKWKN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|