C29H30O5 — CID 163073543
(8S)-5-hydroxy-8-methyl-8-(4-methylpent-3-enyl)-6-(2-methylpropanoyl)-4-phenylpyrano[2,3-h]chromen-2-one (PubChem CID 163073543) has the molecular formula C29H30O5 and a molecular weight of 458.55 g/mol. Its IUPAC name is (8S)-5-hydroxy-8-methyl-8-(4-methylpent-3-enyl)-6-(2-methylpropanoyl)-4-phenylpyrano[2,3-h]chromen-2-one.
| Compound Name | (8S)-5-hydroxy-8-methyl-8-(4-methylpent-3-enyl)-6-(2-methylpropanoyl)-4-phenylpyrano[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 163073543 |
| Molecular Formula | C29H30O5 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (8S)-5-hydroxy-8-methyl-8-(4-methylpent-3-enyl)-6-(2-methylpropanoyl)-4-phenylpyrano[2,3-h]chromen-2-one |
| SMILES | CC(C)=CCC[C@@]1(C)C=Cc2c(c(C(=O)C(C)C)c(O)c3c(-c4ccccc4)cc(=O)oc23)O1 |
| InChI | InChI=1S/C29H30O5/c1-17(2)10-9-14-29(5)15-13-20-27-23(26(32)24(28(20)34-29)25(31)18(3)4)21(16-22(30)33-27)19-11-7-6-8-12-19/h6-8,10-13,15-16,18,32H,9,14H2,1-5H3/t29-/m0/s1 |
| InChIKey | ZAENIFBTEWKTCS-LJAQVGFWSA-N |
| XLogP | 6.91 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|