About 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane
5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane (PubChem CID 160826547) has the molecular formula C21H30O4
and a molecular weight of 346.47 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane.
Molecular Properties
| Compound Name | 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane |
| PubChem CID | 160826547 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane |
| SMILES | C.CCCc1cc(O)c2c(c1C(=O)O)OC(C)(CCC=C(C)C)C=C2 |
| InChI | InChI=1S/C20H26O4.CH4/c1-5-7-14-12-16(21)15-9-11-20(4,10-6-8-13(2)3)24-18(15)17(14)19(22)23;/h8-9,11-12,21H,5-7,10H2,1-4H3,(H,22,23);1H4 |
| InChIKey | SGGCSADVGYSHGU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane?
The IUPAC name of 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane (CID 160826547) is 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane.
What is the SMILES notation for 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane?
The canonical SMILES for 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane is C.CCCc1cc(O)c2c(c1C(=O)O)OC(C)(CCC=C(C)C)C=C2.
What is the InChIKey of 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane?
The InChIKey is SGGCSADVGYSHGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O4.CH4/c1-5-7-14-12-16(21)15-9-11-20(4,10-6-8-13(2)3)24-18(15)17(14)19(22)23;/h8-9,11-12,21H,5-7,10H2,1-4H3,(H,22,23);1H4.
What are the key properties of 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane?
5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane has a molecular weight of 346.47 g/mol, XLogP of 5.59, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-propylchromene-8-carboxylic acid;methane is sourced from PubChem (CID 160826547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).