C22H32O2 — CID 167089283
2,8-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromen-5-ol (PubChem CID 167089283) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2,8-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromen-5-ol.
| Compound Name | 2,8-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromen-5-ol |
|---|---|
| PubChem CID | 167089283 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 2,8-dimethyl-2-(4-methylpent-3-enyl)-7-pentylchromen-5-ol |
| SMILES | CCCCCc1cc(O)c2c(c1C)OC(C)(CCC=C(C)C)C=C2 |
| InChI | InChI=1S/C22H32O2/c1-6-7-8-11-18-15-20(23)19-12-14-22(5,13-9-10-16(2)3)24-21(19)17(18)4/h10,12,14-15,23H,6-9,11,13H2,1-5H3 |
| InChIKey | JWOFAUHIZDXBFI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|