C19H24O4 — CID 162940293
methyl 2-[(2R)-6-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]acetate (PubChem CID 162940293) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl 2-[(2R)-6-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]acetate.
| Compound Name | methyl 2-[(2R)-6-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]acetate |
|---|---|
| PubChem CID | 162940293 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | methyl 2-[(2R)-6-hydroxy-2-methyl-2-(4-methylpent-3-enyl)chromen-8-yl]acetate |
| SMILES | COC(=O)Cc1cc(O)cc2c1O[C@](C)(CCC=C(C)C)C=C2 |
| InChI | InChI=1S/C19H24O4/c1-13(2)6-5-8-19(3)9-7-14-10-16(20)11-15(18(14)23-19)12-17(21)22-4/h6-7,9-11,20H,5,8,12H2,1-4H3/t19-/m1/s1 |
| InChIKey | ZWEPBJKMGSZZLH-LJQANCHMSA-N |
| XLogP | 4.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|