C27H35ClO4 — CID 163185030
(2Z,6Z)-2-[(3R)-3-chloro-4-methylpent-4-enyl]-9-[(2R)-6-hydroxy-2,8-dimethylchromen-2-yl]-6-methylnona-2,6-dienoic acid (PubChem CID 163185030) has the molecular formula C27H35ClO4 and a molecular weight of 459.03 g/mol. Its IUPAC name is (2Z,6Z)-2-[(3R)-3-chloro-4-methylpent-4-enyl]-9-[(2R)-6-hydroxy-2,8-dimethylchromen-2-yl]-6-methylnona-2,6-dienoic acid.
| Compound Name | (2Z,6Z)-2-[(3R)-3-chloro-4-methylpent-4-enyl]-9-[(2R)-6-hydroxy-2,8-dimethylchromen-2-yl]-6-methylnona-2,6-dienoic acid |
|---|---|
| PubChem CID | 163185030 |
| Molecular Formula | C27H35ClO4 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (2Z,6Z)-2-[(3R)-3-chloro-4-methylpent-4-enyl]-9-[(2R)-6-hydroxy-2,8-dimethylchromen-2-yl]-6-methylnona-2,6-dienoic acid |
| SMILES | C=C(C)[C@H](Cl)CC/C(=C/CC/C(C)=C\CC[C@]1(C)C=Cc2cc(O)cc(C)c2O1)C(=O)O |
| InChI | InChI=1S/C27H35ClO4/c1-18(2)24(28)12-11-21(26(30)31)10-6-8-19(3)9-7-14-27(5)15-13-22-17-23(29)16-20(4)25(22)32-27/h9-10,13,15-17,24,29H,1,6-8,11-12,14H2,2-5H3,(H,30,31)/b19-9-,21-10-/t24-,27-/m1/s1 |
| InChIKey | AQCCYRBRVYHDDZ-BJBHUKSESA-N |
| XLogP | 7.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|