C25H34O4 — CID 101265973
ethyl (2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-hydroxy-2,7-dimethylchromene-6-carboxylate (PubChem CID 101265973) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is ethyl (2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-hydroxy-2,7-dimethylchromene-6-carboxylate.
| Compound Name | ethyl (2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-hydroxy-2,7-dimethylchromene-6-carboxylate |
|---|---|
| PubChem CID | 101265973 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | ethyl (2S)-2-[(3E)-4,8-dimethylnona-3,7-dienyl]-5-hydroxy-2,7-dimethylchromene-6-carboxylate |
| SMILES | CCOC(=O)c1c(C)cc2c(c1O)C=C[C@](C)(CC/C=C(\C)CCC=C(C)C)O2 |
| InChI | InChI=1S/C25H34O4/c1-7-28-24(27)22-19(5)16-21-20(23(22)26)13-15-25(6,29-21)14-9-12-18(4)11-8-10-17(2)3/h10,12-13,15-16,26H,7-9,11,14H2,1-6H3/b18-12+/t25-/m0/s1 |
| InChIKey | KUGXZWQECNOJIH-QAKGTIEWSA-N |
| XLogP | 6.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|