C40H52O2 — CID 162664301
4,11-bis[(3E)-4,8-dimethylnona-3,7-dienyl]-4,11-dimethyl-3,12-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),5,8(13),9,14,16-heptaene (PubChem CID 162664301) has the molecular formula C40H52O2 and a molecular weight of 564.85 g/mol. Its IUPAC name is 4,11-bis[(3E)-4,8-dimethylnona-3,7-dienyl]-4,11-dimethyl-3,12-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),5,8(13),9,14,16-heptaene.
| Compound Name | 4,11-bis[(3E)-4,8-dimethylnona-3,7-dienyl]-4,11-dimethyl-3,12-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),5,8(13),9,14,16-heptaene |
|---|---|
| PubChem CID | 162664301 |
| Molecular Formula | C40H52O2 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | 4,11-bis[(3E)-4,8-dimethylnona-3,7-dienyl]-4,11-dimethyl-3,12-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),5,8(13),9,14,16-heptaene |
| SMILES | CC(C)=CCC/C(C)=C/CCC1(C)C=Cc2c3c(c4ccccc4c2O1)OC(C)(CC/C=C(\C)CCC=C(C)C)C=C3 |
| InChI | InChI=1S/C40H52O2/c1-29(2)15-11-17-31(5)19-13-25-39(7)27-23-35-36-24-28-40(8,26-14-20-32(6)18-12-16-30(3)4)42-38(36)34-22-10-9-21-33(34)37(35)41-39/h9-10,15-16,19-24,27-28H,11-14,17-18,25-26H2,1-8H3/b31-19+,32-20+ |
| InChIKey | SZRIUQOLPCIHRA-GKTLAHRSSA-N |
| XLogP | 12.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|