C24H29NO — CID 135271324
2,8-dimethyl-2-(4-methylpent-3-enyl)-6-(4-methylphenyl)chromen-5-amine (PubChem CID 135271324) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is 2,8-dimethyl-2-(4-methylpent-3-enyl)-6-(4-methylphenyl)chromen-5-amine.
| Compound Name | 2,8-dimethyl-2-(4-methylpent-3-enyl)-6-(4-methylphenyl)chromen-5-amine |
|---|---|
| PubChem CID | 135271324 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2,8-dimethyl-2-(4-methylpent-3-enyl)-6-(4-methylphenyl)chromen-5-amine |
| SMILES | CC(C)=CCCC1(C)C=Cc2c(N)c(-c3ccc(C)cc3)cc(C)c2O1 |
| InChI | InChI=1S/C24H29NO/c1-16(2)7-6-13-24(5)14-12-20-22(25)21(15-18(4)23(20)26-24)19-10-8-17(3)9-11-19/h7-12,14-15H,6,13,25H2,1-5H3 |
| InChIKey | IBAIMMDZRZPULU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|