C18H21ClO3 — CID 10245493
8-chloro-5-hydroxy-2,7-dimethyl-2-(4-methylpent-3-enyl)chromene-6-carbaldehyde (PubChem CID 10245493) has the molecular formula C18H21ClO3 and a molecular weight of 320.82 g/mol. Its IUPAC name is 8-chloro-5-hydroxy-2,7-dimethyl-2-(4-methylpent-3-enyl)chromene-6-carbaldehyde.
| Compound Name | 8-chloro-5-hydroxy-2,7-dimethyl-2-(4-methylpent-3-enyl)chromene-6-carbaldehyde |
|---|---|
| PubChem CID | 10245493 |
| Molecular Formula | C18H21ClO3 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 8-chloro-5-hydroxy-2,7-dimethyl-2-(4-methylpent-3-enyl)chromene-6-carbaldehyde |
| SMILES | CC(C)=CCCC1(C)C=Cc2c(O)c(C=O)c(C)c(Cl)c2O1 |
| InChI | InChI=1S/C18H21ClO3/c1-11(2)6-5-8-18(4)9-7-13-16(21)14(10-20)12(3)15(19)17(13)22-18/h6-7,9-10,21H,5,8H2,1-4H3 |
| InChIKey | LKRUMGDCBJPQFA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|