C23H25N3O2 — CID 126565118
4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol (PubChem CID 126565118) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol.
| Compound Name | 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol |
|---|---|
| PubChem CID | 126565118 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol |
| SMILES | CC(C)=CCCC1(C)C=Cc2c(N=[N+]=[N-])c(-c3ccc(O)cc3)cc(C)c2O1 |
| InChI | InChI=1S/C23H25N3O2/c1-15(2)6-5-12-23(4)13-11-19-21(25-26-24)20(14-16(3)22(19)28-23)17-7-9-18(27)10-8-17/h6-11,13-14,27H,5,12H2,1-4H3 |
| InChIKey | JBUOEVUJBZYTIS-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|