About 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol
4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol (PubChem CID 126565118) has the molecular formula C23H25N3O2
and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol.
Molecular Properties
| Compound Name | 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol |
| PubChem CID | 126565118 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol |
| SMILES | CC(C)=CCCC1(C)C=Cc2c(N=[N+]=[N-])c(-c3ccc(O)cc3)cc(C)c2O1 |
| InChI | InChI=1S/C23H25N3O2/c1-15(2)6-5-12-23(4)13-11-19-21(25-26-24)20(14-16(3)22(19)28-23)17-7-9-18(27)10-8-17/h6-11,13-14,27H,5,12H2,1-4H3 |
| InChIKey | JBUOEVUJBZYTIS-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol?
The IUPAC name of 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol (CID 126565118) is 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol.
What is the SMILES notation for 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol?
The canonical SMILES for 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol is CC(C)=CCCC1(C)C=Cc2c(N=[N+]=[N-])c(-c3ccc(O)cc3)cc(C)c2O1.
What is the InChIKey of 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol?
The InChIKey is JBUOEVUJBZYTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3O2/c1-15(2)6-5-12-23(4)13-11-19-21(25-26-24)20(14-16(3)22(19)28-23)17-7-9-18(27)10-8-17/h6-11,13-14,27H,5,12H2,1-4H3.
What are the key properties of 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol?
4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol has a molecular weight of 375.47 g/mol, XLogP of 7.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-azido-2,8-dimethyl-2-(4-methylpent-3-enyl)chromen-6-yl]phenol is sourced from PubChem (CID 126565118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).