C16H20O — CID 177454161
(2R)-2-methyl-2-(4-methylpent-3-enyl)chromene (PubChem CID 177454161) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (2R)-2-methyl-2-(4-methylpent-3-enyl)chromene.
| Compound Name | (2R)-2-methyl-2-(4-methylpent-3-enyl)chromene |
|---|---|
| PubChem CID | 177454161 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (2R)-2-methyl-2-(4-methylpent-3-enyl)chromene |
| SMILES | CC(C)=CCC[C@]1(C)C=Cc2ccccc2O1 |
| InChI | InChI=1S/C16H20O/c1-13(2)7-6-11-16(3)12-10-14-8-4-5-9-15(14)17-16/h4-5,7-10,12H,6,11H2,1-3H3/t16-/m1/s1 |
| InChIKey | HCILSAHRTJJNJS-MRXNPFEDSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|