C25H33NO2 — CID 163126117
3-(4,8-dimethylnona-3,7-dienyl)-3,5-dimethyl-6-oxido-5,6-dihydropyrano[2,3-c]quinolin-6-ium (PubChem CID 163126117) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 3-(4,8-dimethylnona-3,7-dienyl)-3,5-dimethyl-6-oxido-5,6-dihydropyrano[2,3-c]quinolin-6-ium.
| Compound Name | 3-(4,8-dimethylnona-3,7-dienyl)-3,5-dimethyl-6-oxido-5,6-dihydropyrano[2,3-c]quinolin-6-ium |
|---|---|
| PubChem CID | 163126117 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 3-(4,8-dimethylnona-3,7-dienyl)-3,5-dimethyl-6-oxido-5,6-dihydropyrano[2,3-c]quinolin-6-ium |
| SMILES | CC(C)=CCCC(C)=CCCC1(C)C=CC2=C(O1)C(C)[NH+]([O-])c1ccccc12 |
| InChI | InChI=1S/C25H33NO2/c1-18(2)10-8-11-19(3)12-9-16-25(5)17-15-22-21-13-6-7-14-23(21)26(27)20(4)24(22)28-25/h6-7,10,12-15,17,20,26H,8-9,11,16H2,1-5H3 |
| InChIKey | DJCXCGHDKAWMAN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 36.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|