C25H33NO2 — CID 163150511
2-(4,8-dimethylnona-3,7-dienyl)-6-hydroxy-2,5-dimethyl-5H-pyrano[3,2-c]quinoline (PubChem CID 163150511) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 2-(4,8-dimethylnona-3,7-dienyl)-6-hydroxy-2,5-dimethyl-5H-pyrano[3,2-c]quinoline.
| Compound Name | 2-(4,8-dimethylnona-3,7-dienyl)-6-hydroxy-2,5-dimethyl-5H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 163150511 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-(4,8-dimethylnona-3,7-dienyl)-6-hydroxy-2,5-dimethyl-5H-pyrano[3,2-c]quinoline |
| SMILES | CC(C)=CCCC(C)=CCCC1(C)C=CC2=C(O1)c1ccccc1N(O)C2C |
| InChI | InChI=1S/C25H33NO2/c1-18(2)10-8-11-19(3)12-9-16-25(5)17-15-21-20(4)26(27)23-14-7-6-13-22(23)24(21)28-25/h6-7,10,12-15,17,20,27H,8-9,11,16H2,1-5H3 |
| InChIKey | NEIDGUHZMLRMMC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|