C28H30O5 — CID 163049542
(3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-6,11-dihydroxy-3-methylpyrano[2,3-c]xanthen-7-one (PubChem CID 163049542) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is (3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-6,11-dihydroxy-3-methylpyrano[2,3-c]xanthen-7-one.
| Compound Name | (3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-6,11-dihydroxy-3-methylpyrano[2,3-c]xanthen-7-one |
|---|---|
| PubChem CID | 163049542 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (3R)-3-[(3E)-4,8-dimethylnona-3,7-dienyl]-6,11-dihydroxy-3-methylpyrano[2,3-c]xanthen-7-one |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@]1(C)C=Cc2c(cc(O)c3c(=O)c4cccc(O)c4oc23)O1 |
| InChI | InChI=1S/C28H30O5/c1-17(2)8-5-9-18(3)10-7-14-28(4)15-13-19-23(33-28)16-22(30)24-25(31)20-11-6-12-21(29)26(20)32-27(19)24/h6,8,10-13,15-16,29-30H,5,7,9,14H2,1-4H3/b18-10+/t28-/m1/s1 |
| InChIKey | RBHZFZSVMMGEQW-QXTIMZJGSA-N |
| XLogP | 6.99 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|