C24H34O4 — CID 163016024
ethyl 7-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-5-pentylchromene-6-carboxylate (PubChem CID 163016024) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is ethyl 7-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-5-pentylchromene-6-carboxylate.
| Compound Name | ethyl 7-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-5-pentylchromene-6-carboxylate |
|---|---|
| PubChem CID | 163016024 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | ethyl 7-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-5-pentylchromene-6-carboxylate |
| SMILES | CCCCCc1c2c(cc(O)c1C(=O)OCC)OC(C)(CCC=C(C)C)C=C2 |
| InChI | InChI=1S/C24H34O4/c1-6-8-9-12-19-18-13-15-24(5,14-10-11-17(3)4)28-21(18)16-20(25)22(19)23(26)27-7-2/h11,13,15-16,25H,6-10,12,14H2,1-5H3 |
| InChIKey | YGAIMMZUHKEBLV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|