C22H28O2 — CID 163298668
7-hex-5-ynyl-2-methyl-2-(4-methylpent-3-enyl)chromen-5-ol (PubChem CID 163298668) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is 7-hex-5-ynyl-2-methyl-2-(4-methylpent-3-enyl)chromen-5-ol.
| Compound Name | 7-hex-5-ynyl-2-methyl-2-(4-methylpent-3-enyl)chromen-5-ol |
|---|---|
| PubChem CID | 163298668 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 7-hex-5-ynyl-2-methyl-2-(4-methylpent-3-enyl)chromen-5-ol |
| SMILES | C#CCCCCc1cc(O)c2c(c1)OC(C)(CCC=C(C)C)C=C2 |
| InChI | InChI=1S/C22H28O2/c1-5-6-7-8-11-18-15-20(23)19-12-14-22(4,24-21(19)16-18)13-9-10-17(2)3/h1,10,12,14-16,23H,6-9,11,13H2,2-4H3 |
| InChIKey | VEUIZQCGNRHMDH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|