About (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol
(2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol (PubChem CID 162946144) has the molecular formula C22H30O3
and a molecular weight of 342.48 g/mol. Its IUPAC name is (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol.
Molecular Properties
| Compound Name | (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol |
| PubChem CID | 162946144 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol |
| SMILES | C=C(CCC=C(C)C)[C@@H](O)CC[C@]1(C)C=Cc2c(O)cc(C)cc2O1 |
| InChI | InChI=1S/C22H30O3/c1-15(2)7-6-8-17(4)19(23)10-12-22(5)11-9-18-20(24)13-16(3)14-21(18)25-22/h7,9,11,13-14,19,23-24H,4,6,8,10,12H2,1-3,5H3/t19-,22-/m0/s1 |
| InChIKey | RXKAJVPBSTXEAH-UGKGYDQZSA-N |
| XLogP | 5.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol?
The IUPAC name of (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol (CID 162946144) is (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol.
What is the SMILES notation for (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol?
The canonical SMILES for (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol is C=C(CCC=C(C)C)[C@@H](O)CC[C@]1(C)C=Cc2c(O)cc(C)cc2O1.
What is the InChIKey of (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol?
The InChIKey is RXKAJVPBSTXEAH-UGKGYDQZSA-N. The full InChI is InChI=1S/C22H30O3/c1-15(2)7-6-8-17(4)19(23)10-12-22(5)11-9-18-20(24)13-16(3)14-21(18)25-22/h7,9,11,13-14,19,23-24H,4,6,8,10,12H2,1-3,5H3/t19-,22-/m0/s1.
What are the key properties of (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol?
(2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol has a molecular weight of 342.48 g/mol, XLogP of 5.31, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3S)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromen-5-ol is sourced from PubChem (CID 162946144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).