C26H38O7 — CID 163298716
(2S,3S,4R,5R)-6-[7-butyl-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl]oxy-5-(hydroxymethyl)oxane-2,3,4-triol (PubChem CID 163298716) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is (2S,3S,4R,5R)-6-[7-butyl-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl]oxy-5-(hydroxymethyl)oxane-2,3,4-triol.
| Compound Name | (2S,3S,4R,5R)-6-[7-butyl-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl]oxy-5-(hydroxymethyl)oxane-2,3,4-triol |
|---|---|
| PubChem CID | 163298716 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (2S,3S,4R,5R)-6-[7-butyl-2-methyl-2-(4-methylpent-3-enyl)chromen-5-yl]oxy-5-(hydroxymethyl)oxane-2,3,4-triol |
| SMILES | CCCCc1cc(OC2O[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)c2c(c1)OC(C)(CCC=C(C)C)C=C2 |
| InChI | InChI=1S/C26H38O7/c1-5-6-9-17-13-20(31-25-19(15-27)22(28)23(29)24(30)32-25)18-10-12-26(4,33-21(18)14-17)11-7-8-16(2)3/h8,10,12-14,19,22-25,27-30H,5-7,9,11,15H2,1-4H3/t19-,22-,23+,24+,25?,26?/m1/s1 |
| InChIKey | HETFLOZGMGVPFJ-DPIAUKBWSA-N |
| XLogP | 3.32 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|