C30H43NO6 — CID 166461127
4-[[(2S)-3-methyl-1-[(2S)-2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromen-5-yl]oxy-1-oxobutan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 166461127) has the molecular formula C30H43NO6 and a molecular weight of 513.68 g/mol. Its IUPAC name is 4-[[(2S)-3-methyl-1-[(2S)-2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromen-5-yl]oxy-1-oxobutan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S)-3-methyl-1-[(2S)-2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromen-5-yl]oxy-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 166461127 |
| Molecular Formula | C30H43NO6 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 4-[[(2S)-3-methyl-1-[(2S)-2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromen-5-yl]oxy-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCCCCc1cc(OC(=O)[C@@H](NC(=O)CCC(=O)O)C(C)C)c2c(c1)O[C@@](C)(CCC=C(C)C)C=C2 |
| InChI | InChI=1S/C30H43NO6/c1-7-8-9-12-22-18-24(36-29(35)28(21(4)5)31-26(32)13-14-27(33)34)23-15-17-30(6,37-25(23)19-22)16-10-11-20(2)3/h11,15,17-19,21,28H,7-10,12-14,16H2,1-6H3,(H,31,32)(H,33,34)/t28-,30-/m0/s1 |
| InChIKey | CSOKJGDPDDCRTP-JDXGNMNLSA-N |
| XLogP | 6.24 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|