C35H51NO7 — CID 137446464
4-[[(2S)-3-methyl-1-[3-(3-methylbutanoyloxy)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-1-oxobutan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 137446464) has the molecular formula C35H51NO7 and a molecular weight of 597.79 g/mol. Its IUPAC name is 4-[[(2S)-3-methyl-1-[3-(3-methylbutanoyloxy)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-1-oxobutan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S)-3-methyl-1-[3-(3-methylbutanoyloxy)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 137446464 |
| Molecular Formula | C35H51NO7 |
| Molecular Weight | 597.79 g/mol |
| Exact Mass | 597.37 |
| IUPAC Name | 4-[[(2S)-3-methyl-1-[3-(3-methylbutanoyloxy)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OC(=O)CC(C)C)cc(CCCCC)cc1OC(=O)[C@@H](NC(=O)CCC(=O)O)C(C)C |
| InChI | InChI=1S/C35H51NO7/c1-9-10-11-12-25-19-28(42-32(40)17-21(2)3)33(27-18-24(8)13-14-26(27)22(4)5)29(20-25)43-35(41)34(23(6)7)36-30(37)15-16-31(38)39/h18-21,23,26-27,34H,4,9-17H2,1-3,5-8H3,(H,36,37)(H,38,39)/t26?,27?,34-/m0/s1 |
| InChIKey | SNEPORCGXZWXKP-ZKMANVEGSA-N |
| XLogP | 7.30 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.79 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|