C29H42O9 — CID 163298643
2-methyl-2-(4-methylpent-3-enyl)-7-(3-methylpentyl)-5-[(3R,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)oxan-2-yl]oxychromene-6-carboxylic acid (PubChem CID 163298643) has the molecular formula C29H42O9 and a molecular weight of 534.65 g/mol. Its IUPAC name is 2-methyl-2-(4-methylpent-3-enyl)-7-(3-methylpentyl)-5-[(3R,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)oxan-2-yl]oxychromene-6-carboxylic acid.
| Compound Name | 2-methyl-2-(4-methylpent-3-enyl)-7-(3-methylpentyl)-5-[(3R,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)oxan-2-yl]oxychromene-6-carboxylic acid |
|---|---|
| PubChem CID | 163298643 |
| Molecular Formula | C29H42O9 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | 2-methyl-2-(4-methylpent-3-enyl)-7-(3-methylpentyl)-5-[(3R,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)oxan-2-yl]oxychromene-6-carboxylic acid |
| SMILES | CCC(C)CCc1cc2c(c(OC3O[C@H](O)[C@@H](O)[C@H](O)[C@H]3CO)c1C(=O)O)C=CC(C)(CCC=C(C)C)O2 |
| InChI | InChI=1S/C29H42O9/c1-6-17(4)9-10-18-14-21-19(11-13-29(5,38-21)12-7-8-16(2)3)25(22(18)26(33)34)36-28-20(15-30)23(31)24(32)27(35)37-28/h8,11,13-14,17,20,23-24,27-28,30-32,35H,6-7,9-10,12,15H2,1-5H3,(H,33,34)/t17?,20-,23-,24+,27+,28?,29?/m1/s1 |
| InChIKey | NBMAEDRWVCVUOD-FLBBGPEYSA-N |
| XLogP | 3.66 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|