C20H26O4 — CID 126659202
1-[5,7-dimethoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-6-yl]ethanone (PubChem CID 126659202) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-[5,7-dimethoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-6-yl]ethanone.
| Compound Name | 1-[5,7-dimethoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-6-yl]ethanone |
|---|---|
| PubChem CID | 126659202 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[5,7-dimethoxy-2-methyl-2-(4-methylpent-3-enyl)chromen-6-yl]ethanone |
| SMILES | COc1cc2c(c(OC)c1C(C)=O)C=CC(C)(CCC=C(C)C)O2 |
| InChI | InChI=1S/C20H26O4/c1-13(2)8-7-10-20(4)11-9-15-16(24-20)12-17(22-5)18(14(3)21)19(15)23-6/h8-9,11-12H,7,10H2,1-6H3 |
| InChIKey | BXSPYDARLGLDIB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|