C24H25NO3 — CID 163192949
(3R)-10-methoxy-3-methyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazole-8-carbaldehyde (PubChem CID 163192949) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (3R)-10-methoxy-3-methyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazole-8-carbaldehyde.
| Compound Name | (3R)-10-methoxy-3-methyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazole-8-carbaldehyde |
|---|---|
| PubChem CID | 163192949 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (3R)-10-methoxy-3-methyl-3-(4-methylpent-3-enyl)-11H-pyrano[3,2-a]carbazole-8-carbaldehyde |
| SMILES | COc1cc(C=O)cc2c1[nH]c1c3c(ccc12)O[C@](C)(CCC=C(C)C)C=C3 |
| InChI | InChI=1S/C24H25NO3/c1-15(2)6-5-10-24(3)11-9-18-20(28-24)8-7-17-19-12-16(14-26)13-21(27-4)23(19)25-22(17)18/h6-9,11-14,25H,5,10H2,1-4H3/t24-/m1/s1 |
| InChIKey | HZRYDTODSVSHIA-XMMPIXPASA-N |
| XLogP | 6.05 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|