C25H30O3 — CID 102124396
(3R)-3-methyl-3-(4-methylpent-3-enyl)-9-(oxan-2-yloxy)benzo[f]chromene (PubChem CID 102124396) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is (3R)-3-methyl-3-(4-methylpent-3-enyl)-9-(oxan-2-yloxy)benzo[f]chromene.
| Compound Name | (3R)-3-methyl-3-(4-methylpent-3-enyl)-9-(oxan-2-yloxy)benzo[f]chromene |
|---|---|
| PubChem CID | 102124396 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (3R)-3-methyl-3-(4-methylpent-3-enyl)-9-(oxan-2-yloxy)benzo[f]chromene |
| SMILES | CC(C)=CCC[C@]1(C)C=Cc2c(ccc3ccc(OC4CCCCO4)cc23)O1 |
| InChI | InChI=1S/C25H30O3/c1-18(2)7-6-14-25(3)15-13-21-22-17-20(27-24-8-4-5-16-26-24)11-9-19(22)10-12-23(21)28-25/h7,9-13,15,17,24H,4-6,8,14,16H2,1-3H3/t24?,25-/m1/s1 |
| InChIKey | XCXLGCMPEVWLQR-WUBHUQEYSA-N |
| XLogP | 6.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|