C15H17BrO4 — CID 125486916
(2S)-3-bromo-4-methyl-6-[(2S)-oxan-2-yl]oxy-2H-chromen-2-ol (PubChem CID 125486916) has the molecular formula C15H17BrO4 and a molecular weight of 341.20 g/mol. Its IUPAC name is (2S)-3-bromo-4-methyl-6-[(2S)-oxan-2-yl]oxy-2H-chromen-2-ol.
| Compound Name | (2S)-3-bromo-4-methyl-6-[(2S)-oxan-2-yl]oxy-2H-chromen-2-ol |
|---|---|
| PubChem CID | 125486916 |
| Molecular Formula | C15H17BrO4 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (2S)-3-bromo-4-methyl-6-[(2S)-oxan-2-yl]oxy-2H-chromen-2-ol |
| SMILES | CC1=C(Br)[C@@H](O)Oc2ccc(O[C@H]3CCCCO3)cc21 |
| InChI | InChI=1S/C15H17BrO4/c1-9-11-8-10(19-13-4-2-3-7-18-13)5-6-12(11)20-15(17)14(9)16/h5-6,8,13,15,17H,2-4,7H2,1H3/t13-,15-/m0/s1 |
| InChIKey | WRBXUIVBOZOPQM-ZFWWWQNUSA-N |
| XLogP | 3.43 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |