C35H38O6 — CID 129079943
(E)-3-[4-[4-methyl-6-(oxan-2-yloxy)-3-[3-(oxan-2-yloxy)phenyl]-2H-chromen-2-yl]phenyl]prop-2-en-1-ol (PubChem CID 129079943) has the molecular formula C35H38O6 and a molecular weight of 554.68 g/mol. Its IUPAC name is (E)-3-[4-[4-methyl-6-(oxan-2-yloxy)-3-[3-(oxan-2-yloxy)phenyl]-2H-chromen-2-yl]phenyl]prop-2-en-1-ol.
| Compound Name | (E)-3-[4-[4-methyl-6-(oxan-2-yloxy)-3-[3-(oxan-2-yloxy)phenyl]-2H-chromen-2-yl]phenyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 129079943 |
| Molecular Formula | C35H38O6 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | (E)-3-[4-[4-methyl-6-(oxan-2-yloxy)-3-[3-(oxan-2-yloxy)phenyl]-2H-chromen-2-yl]phenyl]prop-2-en-1-ol |
| SMILES | CC1=C(c2cccc(OC3CCCCO3)c2)C(c2ccc(/C=C/CO)cc2)Oc2ccc(OC3CCCCO3)cc21 |
| InChI | InChI=1S/C35H38O6/c1-24-30-23-29(40-33-12-3-5-21-38-33)17-18-31(30)41-35(26-15-13-25(14-16-26)8-7-19-36)34(24)27-9-6-10-28(22-27)39-32-11-2-4-20-37-32/h6-10,13-18,22-23,32-33,35-36H,2-5,11-12,19-21H2,1H3/b8-7+ |
| InChIKey | XXAZSMROGMXGOP-BQYQJAHWSA-N |
| XLogP | 7.57 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|