C34H38N2O4 — CID 145193208
N-[2-methanimidoyl-4-[4-methyl-2-(4-methylphenyl)-6-(oxan-2-yloxy)-2H-chromen-3-yl]phenyl]oxan-2-amine (PubChem CID 145193208) has the molecular formula C34H38N2O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is N-[2-methanimidoyl-4-[4-methyl-2-(4-methylphenyl)-6-(oxan-2-yloxy)-2H-chromen-3-yl]phenyl]oxan-2-amine.
| Compound Name | N-[2-methanimidoyl-4-[4-methyl-2-(4-methylphenyl)-6-(oxan-2-yloxy)-2H-chromen-3-yl]phenyl]oxan-2-amine |
|---|---|
| PubChem CID | 145193208 |
| Molecular Formula | C34H38N2O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | N-[2-methanimidoyl-4-[4-methyl-2-(4-methylphenyl)-6-(oxan-2-yloxy)-2H-chromen-3-yl]phenyl]oxan-2-amine |
| SMILES | [H]/N=C/c1cc(C2=C(C)c3cc(OC4CCCCO4)ccc3OC2c2ccc(C)cc2)ccc1NC1CCCCO1 |
| InChI | InChI=1S/C34H38N2O4/c1-22-9-11-24(12-10-22)34-33(25-13-15-29(26(19-25)21-35)36-31-7-3-5-17-37-31)23(2)28-20-27(14-16-30(28)40-34)39-32-8-4-6-18-38-32/h9-16,19-21,31-32,34-36H,3-8,17-18H2,1-2H3/b35-21+ |
| InChIKey | GDJIDOQNVUDONQ-XICOUIIWSA-N |
| XLogP | 7.90 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|