C19H25ClN2O2 — CID 155734773
N-[4-chloro-2-methanimidoyl-5-(4-methoxy-4-methylpent-1-ynyl)phenyl]oxan-2-amine (PubChem CID 155734773) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is N-[4-chloro-2-methanimidoyl-5-(4-methoxy-4-methylpent-1-ynyl)phenyl]oxan-2-amine.
| Compound Name | N-[4-chloro-2-methanimidoyl-5-(4-methoxy-4-methylpent-1-ynyl)phenyl]oxan-2-amine |
|---|---|
| PubChem CID | 155734773 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[4-chloro-2-methanimidoyl-5-(4-methoxy-4-methylpent-1-ynyl)phenyl]oxan-2-amine |
| SMILES | [H]/N=C/c1cc(Cl)c(C#CCC(C)(C)OC)cc1NC1CCCCO1 |
| InChI | InChI=1S/C19H25ClN2O2/c1-19(2,23-3)9-6-7-14-12-17(15(13-21)11-16(14)20)22-18-8-4-5-10-24-18/h11-13,18,21-22H,4-5,8-10H2,1-3H3/b21-13+ |
| InChIKey | WJNYGFYPIUJFJC-FYJGNVAPSA-N |
| XLogP | 4.44 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|