C16H23ClN4O2 — CID 142525089
6-chloro-3-methanimidoyl-4-[(1-methylazetidin-3-yl)methoxy]-N-(oxan-2-yl)pyridin-2-amine (PubChem CID 142525089) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 6-chloro-3-methanimidoyl-4-[(1-methylazetidin-3-yl)methoxy]-N-(oxan-2-yl)pyridin-2-amine.
| Compound Name | 6-chloro-3-methanimidoyl-4-[(1-methylazetidin-3-yl)methoxy]-N-(oxan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 142525089 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 6-chloro-3-methanimidoyl-4-[(1-methylazetidin-3-yl)methoxy]-N-(oxan-2-yl)pyridin-2-amine |
| SMILES | [H]/N=C/c1c(OCC2CN(C)C2)cc(Cl)nc1NC1CCCCO1 |
| InChI | InChI=1S/C16H23ClN4O2/c1-21-8-11(9-21)10-23-13-6-14(17)19-16(12(13)7-18)20-15-4-2-3-5-22-15/h6-7,11,15,18H,2-5,8-10H2,1H3,(H,19,20)/b18-7+ |
| InChIKey | RRLKXWOYAOJSDP-CNHKJKLMSA-N |
| XLogP | 2.61 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|