C14H20ClN5O2 — CID 145480232
2-chloro-5-methanimidoyl-6-morpholin-4-yl-N-(oxan-2-yl)pyrimidin-4-amine (PubChem CID 145480232) has the molecular formula C14H20ClN5O2 and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-chloro-5-methanimidoyl-6-morpholin-4-yl-N-(oxan-2-yl)pyrimidin-4-amine.
| Compound Name | 2-chloro-5-methanimidoyl-6-morpholin-4-yl-N-(oxan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 145480232 |
| Molecular Formula | C14H20ClN5O2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-chloro-5-methanimidoyl-6-morpholin-4-yl-N-(oxan-2-yl)pyrimidin-4-amine |
| SMILES | [H]/N=C/c1c(NC2CCCCO2)nc(Cl)nc1N1CCOCC1 |
| InChI | InChI=1S/C14H20ClN5O2/c15-14-18-12(17-11-3-1-2-6-22-11)10(9-16)13(19-14)20-4-7-21-8-5-20/h9,11,16H,1-8H2,(H,17,18,19)/b16-9+ |
| InChIKey | QYKHXVRKWQWFMV-CXUHLZMHSA-N |
| XLogP | 1.90 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|