C14H19FN2O2 — CID 139376447
2-fluoro-6-methanimidoyl-3,4-dimethyl-5-(oxan-2-ylamino)phenol (PubChem CID 139376447) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-fluoro-6-methanimidoyl-3,4-dimethyl-5-(oxan-2-ylamino)phenol.
| Compound Name | 2-fluoro-6-methanimidoyl-3,4-dimethyl-5-(oxan-2-ylamino)phenol |
|---|---|
| PubChem CID | 139376447 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-fluoro-6-methanimidoyl-3,4-dimethyl-5-(oxan-2-ylamino)phenol |
| SMILES | [H]/N=C/c1c(O)c(F)c(C)c(C)c1NC1CCCCO1 |
| InChI | InChI=1S/C14H19FN2O2/c1-8-9(2)13(10(7-16)14(18)12(8)15)17-11-5-3-4-6-19-11/h7,11,16-18H,3-6H2,1-2H3/b16-7+ |
| InChIKey | DCIMMYKOMYBJMR-FRKPEAEDSA-N |
| XLogP | 3.08 |
| TPSA | 65.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|