C12H13BrF2N2O2 — CID 171077735
2-bromo-5,6-difluoro-3-methanimidoyl-4-(oxan-2-ylamino)phenol (PubChem CID 171077735) has the molecular formula C12H13BrF2N2O2 and a molecular weight of 335.15 g/mol. Its IUPAC name is 2-bromo-5,6-difluoro-3-methanimidoyl-4-(oxan-2-ylamino)phenol.
| Compound Name | 2-bromo-5,6-difluoro-3-methanimidoyl-4-(oxan-2-ylamino)phenol |
|---|---|
| PubChem CID | 171077735 |
| Molecular Formula | C12H13BrF2N2O2 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-bromo-5,6-difluoro-3-methanimidoyl-4-(oxan-2-ylamino)phenol |
| SMILES | [H]/N=C/c1c(Br)c(O)c(F)c(F)c1NC1CCCCO1 |
| InChI | InChI=1S/C12H13BrF2N2O2/c13-8-6(5-16)11(9(14)10(15)12(8)18)17-7-3-1-2-4-19-7/h5,7,16-18H,1-4H2/b16-5+ |
| InChIKey | JHFMWEIALZIIME-FZSIALSZSA-N |
| XLogP | 3.37 |
| TPSA | 65.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|