C25H31BrFN3O4 — CID 135275317
tert-butyl N-[2-[6-bromo-2-methanimidoyl-3-(oxan-2-ylamino)phenoxy]-1-(4-fluorophenyl)ethyl]carbamate (PubChem CID 135275317) has the molecular formula C25H31BrFN3O4 and a molecular weight of 536.44 g/mol. Its IUPAC name is tert-butyl N-[2-[6-bromo-2-methanimidoyl-3-(oxan-2-ylamino)phenoxy]-1-(4-fluorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-bromo-2-methanimidoyl-3-(oxan-2-ylamino)phenoxy]-1-(4-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 135275317 |
| Molecular Formula | C25H31BrFN3O4 |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | tert-butyl N-[2-[6-bromo-2-methanimidoyl-3-(oxan-2-ylamino)phenoxy]-1-(4-fluorophenyl)ethyl]carbamate |
| SMILES | [H]/N=C/c1c(NC2CCCCO2)ccc(Br)c1OCC(NC(=O)OC(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H31BrFN3O4/c1-25(2,3)34-24(31)30-21(16-7-9-17(27)10-8-16)15-33-23-18(14-28)20(12-11-19(23)26)29-22-6-4-5-13-32-22/h7-12,14,21-22,28-29H,4-6,13,15H2,1-3H3,(H,30,31)/b28-14+ |
| InChIKey | WRNYPWDTJUFVJV-CCVNUDIWSA-N |
| XLogP | 6.17 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|