C27H39NO8 — CID 24879559
ethyl (E)-3-[(2S)-2-[(1R)-1-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-2-yloxy)ethyl]phenoxy]ethyl]oxiran-2-yl]prop-2-enoate (PubChem CID 24879559) has the molecular formula C27H39NO8 and a molecular weight of 505.61 g/mol. Its IUPAC name is ethyl (E)-3-[(2S)-2-[(1R)-1-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-2-yloxy)ethyl]phenoxy]ethyl]oxiran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S)-2-[(1R)-1-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-2-yloxy)ethyl]phenoxy]ethyl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 24879559 |
| Molecular Formula | C27H39NO8 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | ethyl (E)-3-[(2S)-2-[(1R)-1-[4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxan-2-yloxy)ethyl]phenoxy]ethyl]oxiran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@]1([C@@H](C)Oc2ccc([C@@H](COC3CCCCO3)NC(=O)OC(C)(C)C)cc2)CO1 |
| InChI | InChI=1S/C27H39NO8/c1-6-31-23(29)14-15-27(18-34-27)19(2)35-21-12-10-20(11-13-21)22(28-25(30)36-26(3,4)5)17-33-24-9-7-8-16-32-24/h10-15,19,22,24H,6-9,16-18H2,1-5H3,(H,28,30)/b15-14+/t19-,22-,24?,27+/m1/s1 |
| InChIKey | FWASULNLKPWFEQ-UXGPTFECSA-N |
| XLogP | 4.45 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|