C13H17N3O3 — CID 139365930
N-(2-methanimidoyl-3-methyl-4-nitrophenyl)oxan-2-amine (PubChem CID 139365930) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(2-methanimidoyl-3-methyl-4-nitrophenyl)oxan-2-amine.
| Compound Name | N-(2-methanimidoyl-3-methyl-4-nitrophenyl)oxan-2-amine |
|---|---|
| PubChem CID | 139365930 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(2-methanimidoyl-3-methyl-4-nitrophenyl)oxan-2-amine |
| SMILES | [H]/N=C/c1c(NC2CCCCO2)ccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H17N3O3/c1-9-10(8-14)11(5-6-12(9)16(17)18)15-13-4-2-3-7-19-13/h5-6,8,13-15H,2-4,7H2,1H3/b14-8+ |
| InChIKey | HPIHQLNTXNQMJX-RIYZIHGNSA-N |
| XLogP | 2.84 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|