C19H29BN2O3 — CID 155647290
N-[2-methanimidoyl-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-2-amine (PubChem CID 155647290) has the molecular formula C19H29BN2O3 and a molecular weight of 344.26 g/mol. Its IUPAC name is N-[2-methanimidoyl-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-2-amine.
| Compound Name | N-[2-methanimidoyl-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-2-amine |
|---|---|
| PubChem CID | 155647290 |
| Molecular Formula | C19H29BN2O3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | N-[2-methanimidoyl-4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxan-2-amine |
| SMILES | [H]/N=C/c1c(NC2CCCCO2)ccc(C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H29BN2O3/c1-13-9-10-15(22-16-8-6-7-11-23-16)14(12-21)17(13)20-24-18(2,3)19(4,5)25-20/h9-10,12,16,21-22H,6-8,11H2,1-5H3/b21-12+ |
| InChIKey | PFMMKALRGACUMX-CIAFOILYSA-N |
| XLogP | 3.23 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|