C14H22BN2O2P — CID 170589898
2-methanimidoyl-4-methyl-6-phosphanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 170589898) has the molecular formula C14H22BN2O2P and a molecular weight of 292.13 g/mol. Its IUPAC name is 2-methanimidoyl-4-methyl-6-phosphanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 2-methanimidoyl-4-methyl-6-phosphanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 170589898 |
| Molecular Formula | C14H22BN2O2P |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-methanimidoyl-4-methyl-6-phosphanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | [H]/N=C/c1c(N)c(P)cc(C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H22BN2O2P/c1-8-6-10(20)12(17)9(7-16)11(8)15-18-13(2,3)14(4,5)19-15/h6-7,16H,17,20H2,1-5H3/b16-7+ |
| InChIKey | IHAOZEJNFQQCOH-FRKPEAEDSA-N |
| XLogP | 1.37 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|