C12H20N2 — CID 169182413
ethane;2-methanimidoyl-3,4,5-trimethylaniline (PubChem CID 169182413) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;2-methanimidoyl-3,4,5-trimethylaniline.
| Compound Name | ethane;2-methanimidoyl-3,4,5-trimethylaniline |
|---|---|
| PubChem CID | 169182413 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;2-methanimidoyl-3,4,5-trimethylaniline |
| SMILES | CC.[H]/N=C/c1c(N)cc(C)c(C)c1C |
| InChI | InChI=1S/C10H14N2.C2H6/c1-6-4-10(12)9(5-11)8(3)7(6)2;1-2/h4-5,11H,12H2,1-3H3;1-2H3/b11-5+; |
| InChIKey | AMQRMYQEAZMPOA-HMXKFKBXSA-N |
| XLogP | 3.22 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|