About ethane;2-methanimidoyl-3,4,5-trimethylaniline
ethane;2-methanimidoyl-3,4,5-trimethylaniline (PubChem CID 169182413) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;2-methanimidoyl-3,4,5-trimethylaniline.
Molecular Properties
| Compound Name | ethane;2-methanimidoyl-3,4,5-trimethylaniline |
| PubChem CID | 169182413 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;2-methanimidoyl-3,4,5-trimethylaniline |
| SMILES | CC.[H]/N=C/c1c(N)cc(C)c(C)c1C |
| InChI | InChI=1S/C10H14N2.C2H6/c1-6-4-10(12)9(5-11)8(3)7(6)2;1-2/h4-5,11H,12H2,1-3H3;1-2H3/b11-5+; |
| InChIKey | AMQRMYQEAZMPOA-HMXKFKBXSA-N |
| XLogP | 3.22 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methanimidoyl-3,4,5-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methanimidoyl-3,4,5-trimethylaniline?
The IUPAC name of ethane;2-methanimidoyl-3,4,5-trimethylaniline (CID 169182413) is ethane;2-methanimidoyl-3,4,5-trimethylaniline.
What is the SMILES notation for ethane;2-methanimidoyl-3,4,5-trimethylaniline?
The canonical SMILES for ethane;2-methanimidoyl-3,4,5-trimethylaniline is CC.[H]/N=C/c1c(N)cc(C)c(C)c1C.
What is the InChIKey of ethane;2-methanimidoyl-3,4,5-trimethylaniline?
The InChIKey is AMQRMYQEAZMPOA-HMXKFKBXSA-N. The full InChI is InChI=1S/C10H14N2.C2H6/c1-6-4-10(12)9(5-11)8(3)7(6)2;1-2/h4-5,11H,12H2,1-3H3;1-2H3/b11-5+;.
What are the key properties of ethane;2-methanimidoyl-3,4,5-trimethylaniline?
ethane;2-methanimidoyl-3,4,5-trimethylaniline has a molecular weight of 192.31 g/mol, XLogP of 3.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methanimidoyl-3,4,5-trimethylaniline is sourced from PubChem (CID 169182413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).