C14H25FN2 — CID 176566300
ethane;2-ethanimidoyl-3-fluoro-4,5-dimethylaniline (PubChem CID 176566300) has the molecular formula C14H25FN2 and a molecular weight of 240.37 g/mol. Its IUPAC name is ethane;2-ethanimidoyl-3-fluoro-4,5-dimethylaniline.
| Compound Name | ethane;2-ethanimidoyl-3-fluoro-4,5-dimethylaniline |
|---|---|
| PubChem CID | 176566300 |
| Molecular Formula | C14H25FN2 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | ethane;2-ethanimidoyl-3-fluoro-4,5-dimethylaniline |
| SMILES | CC.CC.[H]/N=C(\C)c1c(N)cc(C)c(C)c1F |
| InChI | InChI=1S/C10H13FN2.2C2H6/c1-5-4-8(13)9(7(3)12)10(11)6(5)2;2*1-2/h4,12H,13H2,1-3H3;2*1-2H3/b12-7+;; |
| InChIKey | ZNVBCCATEIGJHM-CURPJKDSSA-N |
| XLogP | 4.46 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|