C7H10N4 — CID 169111113
3-methanimidoyl-5-methylpyridine-2,4-diamine (PubChem CID 169111113) has the molecular formula C7H10N4 and a molecular weight of 150.19 g/mol. Its IUPAC name is 3-methanimidoyl-5-methylpyridine-2,4-diamine.
| Compound Name | 3-methanimidoyl-5-methylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 169111113 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 3-methanimidoyl-5-methylpyridine-2,4-diamine |
| SMILES | [H]/N=C/c1c(N)ncc(C)c1N |
| InChI | InChI=1S/C7H10N4/c1-4-3-11-7(10)5(2-8)6(4)9/h2-3,8H,1H3,(H4,9,10,11)/b8-2+ |
| InChIKey | NMMZCKXPJKUHFJ-KRXBUXKQSA-N |
| XLogP | 0.55 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|