C19H21F3N6O2 — CID 169111836
N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-N'-methyl-N'-[(1S)-1-[2-methyl-4-(trifluoromethyl)phenyl]ethyl]oxamide (PubChem CID 169111836) has the molecular formula C19H21F3N6O2 and a molecular weight of 422.41 g/mol. Its IUPAC name is N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-N'-methyl-N'-[(1S)-1-[2-methyl-4-(trifluoromethyl)phenyl]ethyl]oxamide.
| Compound Name | N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-N'-methyl-N'-[(1S)-1-[2-methyl-4-(trifluoromethyl)phenyl]ethyl]oxamide |
|---|---|
| PubChem CID | 169111836 |
| Molecular Formula | C19H21F3N6O2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-N'-methyl-N'-[(1S)-1-[2-methyl-4-(trifluoromethyl)phenyl]ethyl]oxamide |
| SMILES | [H]/N=C/c1c(N)ncc(NC(=O)C(=O)N(C)[C@@H](C)c2ccc(C(F)(F)F)cc2C)c1N |
| InChI | InChI=1S/C19H21F3N6O2/c1-9-6-11(19(20,21)22)4-5-12(9)10(2)28(3)18(30)17(29)27-14-8-26-16(25)13(7-23)15(14)24/h4-8,10,23H,1-3H3,(H,27,29)(H4,24,25,26)/b23-7+/t10-/m0/s1 |
| InChIKey | UIQLMAKYAQVMDQ-WSCDXFLVSA-N |
| XLogP | 2.73 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|