C18H16F4IN6O2P — CID 169111778
N-(4-amino-1-iodophosphanylpyrazolo[4,5-c]pyridin-7-yl)-N'-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]-N'-methyloxamide (PubChem CID 169111778) has the molecular formula C18H16F4IN6O2P and a molecular weight of 582.24 g/mol. Its IUPAC name is N-(4-amino-1-iodophosphanylpyrazolo[4,5-c]pyridin-7-yl)-N'-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]-N'-methyloxamide.
| Compound Name | N-(4-amino-1-iodophosphanylpyrazolo[4,5-c]pyridin-7-yl)-N'-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 169111778 |
| Molecular Formula | C18H16F4IN6O2P |
| Molecular Weight | 582.24 g/mol |
| Exact Mass | 582.01 |
| IUPAC Name | N-(4-amino-1-iodophosphanylpyrazolo[4,5-c]pyridin-7-yl)-N'-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl]-N'-methyloxamide |
| SMILES | CC(c1ccc(C(F)(F)F)cc1F)N(C)C(=O)C(=O)Nc1cnc(N)c2cnn(PI)c12 |
| InChI | InChI=1S/C18H16F4IN6O2P/c1-8(10-4-3-9(5-12(10)19)18(20,21)22)28(2)17(31)16(30)27-13-7-25-15(24)11-6-26-29(32-23)14(11)13/h3-8,32H,1-2H3,(H2,24,25)(H,27,30) |
| InChIKey | FEORERJQVDFSKT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|