C14H12F7NO3 — CID 169112090
2,2,2-trifluoroethyl 2-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl-methylamino]-2-oxoacetate (PubChem CID 169112090) has the molecular formula C14H12F7NO3 and a molecular weight of 375.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl-methylamino]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl-methylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 169112090 |
| Molecular Formula | C14H12F7NO3 |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethyl-methylamino]-2-oxoacetate |
| SMILES | CC(c1ccc(C(F)(F)F)cc1F)N(C)C(=O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C14H12F7NO3/c1-7(9-4-3-8(5-10(9)15)14(19,20)21)22(2)11(23)12(24)25-6-13(16,17)18/h3-5,7H,6H2,1-2H3 |
| InChIKey | OVIPTHZGVBVPQS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|