C20H20N8O2 — CID 169112049
N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-N',N'-bis(pyridin-2-ylmethyl)oxamide (PubChem CID 169112049) has the molecular formula C20H20N8O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-N',N'-bis(pyridin-2-ylmethyl)oxamide.
| Compound Name | N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-N',N'-bis(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 169112049 |
| Molecular Formula | C20H20N8O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-(4,6-diamino-5-methanimidoyl-3-pyridinyl)-N',N'-bis(pyridin-2-ylmethyl)oxamide |
| SMILES | [H]/N=C/c1c(N)ncc(NC(=O)C(=O)N(Cc2ccccn2)Cc2ccccn2)c1N |
| InChI | InChI=1S/C20H20N8O2/c21-9-15-17(22)16(10-26-18(15)23)27-19(29)20(30)28(11-13-5-1-3-7-24-13)12-14-6-2-4-8-25-14/h1-10,21H,11-12H2,(H,27,29)(H4,22,23,26)/b21-9+ |
| InChIKey | IKSRVHNTVZGRTP-ZVBGSRNCSA-N |
| XLogP | 1.20 |
| TPSA | 163.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|