C18H21N5O3 — CID 143649879
aniline;2-[2,3-diiminobutanoyl(pyridin-2-ylmethyl)amino]acetic acid (PubChem CID 143649879) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is aniline;2-[2,3-diiminobutanoyl(pyridin-2-ylmethyl)amino]acetic acid.
| Compound Name | aniline;2-[2,3-diiminobutanoyl(pyridin-2-ylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 143649879 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | aniline;2-[2,3-diiminobutanoyl(pyridin-2-ylmethyl)amino]acetic acid |
| SMILES | Nc1ccccc1.[H]/N=C(C)/C(=N\[H])C(=O)N(CC(=O)O)Cc1ccccn1 |
| InChI | InChI=1S/C12H14N4O3.C6H7N/c1-8(13)11(14)12(19)16(7-10(17)18)6-9-4-2-3-5-15-9;7-6-4-2-1-3-5-6/h2-5,13-14H,6-7H2,1H3,(H,17,18);1-5H,7H2/b13-8+,14-11+; |
| InChIKey | CXGKOKFDXNIHOF-QBFZYDLUSA-N |
| XLogP | 1.82 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|