About 2-methanimidoylbenzene-1,3-diamine
2-methanimidoylbenzene-1,3-diamine (PubChem CID 88563224) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-methanimidoylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 2-methanimidoylbenzene-1,3-diamine |
| PubChem CID | 88563224 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 2-methanimidoylbenzene-1,3-diamine |
| SMILES | [H]/N=C/c1c(N)cccc1N |
| InChI | InChI=1S/C7H9N3/c8-4-5-6(9)2-1-3-7(5)10/h1-4,8H,9-10H2/b8-4+ |
| InChIKey | XIBTUOXKYXLANC-XBXARRHUSA-N |
| XLogP | 0.85 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methanimidoylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanimidoylbenzene-1,3-diamine?
The IUPAC name of 2-methanimidoylbenzene-1,3-diamine (CID 88563224) is 2-methanimidoylbenzene-1,3-diamine.
What is the SMILES notation for 2-methanimidoylbenzene-1,3-diamine?
The canonical SMILES for 2-methanimidoylbenzene-1,3-diamine is [H]/N=C/c1c(N)cccc1N.
What is the InChIKey of 2-methanimidoylbenzene-1,3-diamine?
The InChIKey is XIBTUOXKYXLANC-XBXARRHUSA-N. The full InChI is InChI=1S/C7H9N3/c8-4-5-6(9)2-1-3-7(5)10/h1-4,8H,9-10H2/b8-4+.
What are the key properties of 2-methanimidoylbenzene-1,3-diamine?
2-methanimidoylbenzene-1,3-diamine has a molecular weight of 135.17 g/mol, XLogP of 0.85, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanimidoylbenzene-1,3-diamine is sourced from PubChem (CID 88563224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).