About 2-methylbenzene-1,3-diamine;dihydrochloride
2-methylbenzene-1,3-diamine;dihydrochloride (PubChem CID 27324) has the molecular formula C7H12Cl2N2
and a molecular weight of 195.09 g/mol. Its IUPAC name is 2-methylbenzene-1,3-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-methylbenzene-1,3-diamine;dihydrochloride |
| PubChem CID | 27324 |
| Molecular Formula | C7H12Cl2N2 |
| Molecular Weight | 195.09 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-methylbenzene-1,3-diamine;dihydrochloride |
| SMILES | Cc1c(N)cccc1N.Cl.Cl |
| InChI | InChI=1S/C7H10N2.2ClH/c1-5-6(8)3-2-4-7(5)9;;/h2-4H,8-9H2,1H3;2*1H |
| InChIKey | LXIJUYQULXUMDO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.09 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzene-1,3-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzene-1,3-diamine;dihydrochloride?
The IUPAC name of 2-methylbenzene-1,3-diamine;dihydrochloride (CID 27324) is 2-methylbenzene-1,3-diamine;dihydrochloride.
What is the SMILES notation for 2-methylbenzene-1,3-diamine;dihydrochloride?
The canonical SMILES for 2-methylbenzene-1,3-diamine;dihydrochloride is Cc1c(N)cccc1N.Cl.Cl.
What is the InChIKey of 2-methylbenzene-1,3-diamine;dihydrochloride?
The InChIKey is LXIJUYQULXUMDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.2ClH/c1-5-6(8)3-2-4-7(5)9;;/h2-4H,8-9H2,1H3;2*1H.
What are the key properties of 2-methylbenzene-1,3-diamine;dihydrochloride?
2-methylbenzene-1,3-diamine;dihydrochloride has a molecular weight of 195.09 g/mol, XLogP of 2.00, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzene-1,3-diamine;dihydrochloride is sourced from PubChem (CID 27324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).